N-(3-methoxyphenyl)-4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanamide
Chemical Structure Depiction of
N-(3-methoxyphenyl)-4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanamide
N-(3-methoxyphenyl)-4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanamide
Compound characteristics
| Compound ID: | D134-0210 |
| Compound Name: | N-(3-methoxyphenyl)-4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanamide |
| Molecular Weight: | 351.4 |
| Molecular Formula: | C20 H21 N3 O3 |
| Smiles: | Cc1ccc(cc1)c1nc(CCCC(Nc2cccc(c2)OC)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.3106 |
| logD: | 4.3105 |
| logSw: | -4.3538 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.003 |
| InChI Key: | QCBOYZWFAUNSLH-UHFFFAOYSA-N |