N-(2,4-dimethylphenyl)-4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]butanamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]butanamide
N-(2,4-dimethylphenyl)-4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]butanamide
Compound characteristics
| Compound ID: | D134-0393 |
| Compound Name: | N-(2,4-dimethylphenyl)-4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]butanamide |
| Molecular Weight: | 365.43 |
| Molecular Formula: | C21 H23 N3 O3 |
| Smiles: | Cc1ccc(c(C)c1)NC(CCCc1nc(c2ccc(cc2)OC)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2857 |
| logD: | 4.2857 |
| logSw: | -4.3157 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.305 |
| InChI Key: | QFOUZOJCTPHIKZ-UHFFFAOYSA-N |