4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)butanamide
Chemical Structure Depiction of
4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)butanamide
4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)butanamide
Compound characteristics
| Compound ID: | D134-0627 |
| Compound Name: | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)butanamide |
| Molecular Weight: | 369.85 |
| Molecular Formula: | C20 H20 Cl N3 O2 |
| Smiles: | C(CC(NCCc1ccccc1)=O)Cc1nc(c2ccc(cc2)[Cl])no1 |
| Stereo: | ACHIRAL |
| logP: | 3.8904 |
| logD: | 3.8904 |
| logSw: | -4.5406 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.623 |
| InChI Key: | NVDLHXKVNCWCFY-UHFFFAOYSA-N |