3-{1-[2-(3-methoxyanilino)-2-oxoethyl]-5-(4-methylphenyl)-1H-pyrrol-2-yl}propanoic acid
Chemical Structure Depiction of
3-{1-[2-(3-methoxyanilino)-2-oxoethyl]-5-(4-methylphenyl)-1H-pyrrol-2-yl}propanoic acid
3-{1-[2-(3-methoxyanilino)-2-oxoethyl]-5-(4-methylphenyl)-1H-pyrrol-2-yl}propanoic acid
Compound characteristics
| Compound ID: | D135-0123 |
| Compound Name: | 3-{1-[2-(3-methoxyanilino)-2-oxoethyl]-5-(4-methylphenyl)-1H-pyrrol-2-yl}propanoic acid |
| Molecular Weight: | 392.45 |
| Molecular Formula: | C23 H24 N2 O4 |
| Smiles: | Cc1ccc(cc1)c1ccc(CCC(O)=O)n1CC(Nc1cccc(c1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5479 |
| logD: | 1.734 |
| logSw: | -4.3099 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.729 |
| InChI Key: | CMRWROXCXJHLST-UHFFFAOYSA-N |