3-[1-{2-[2-(methoxycarbonyl)anilino]-2-oxoethyl}-5-(4-methylphenyl)-1H-pyrrol-2-yl]propanoic acid
Chemical Structure Depiction of
3-[1-{2-[2-(methoxycarbonyl)anilino]-2-oxoethyl}-5-(4-methylphenyl)-1H-pyrrol-2-yl]propanoic acid
3-[1-{2-[2-(methoxycarbonyl)anilino]-2-oxoethyl}-5-(4-methylphenyl)-1H-pyrrol-2-yl]propanoic acid
Compound characteristics
| Compound ID: | D135-0160 |
| Compound Name: | 3-[1-{2-[2-(methoxycarbonyl)anilino]-2-oxoethyl}-5-(4-methylphenyl)-1H-pyrrol-2-yl]propanoic acid |
| Molecular Weight: | 420.46 |
| Molecular Formula: | C24 H24 N2 O5 |
| Smiles: | Cc1ccc(cc1)c1ccc(CCC(O)=O)n1CC(Nc1ccccc1C(=O)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.206 |
| logD: | 1.3922 |
| logSw: | -4.1067 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.661 |
| InChI Key: | GXCGQTMWSBMOCW-UHFFFAOYSA-N |