2-(3-chlorophenoxy)-N-cyclohexyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propanamide
Chemical Structure Depiction of
2-(3-chlorophenoxy)-N-cyclohexyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propanamide
2-(3-chlorophenoxy)-N-cyclohexyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propanamide
Compound characteristics
| Compound ID: | D138-0029 |
| Compound Name: | 2-(3-chlorophenoxy)-N-cyclohexyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propanamide |
| Molecular Weight: | 439.94 |
| Molecular Formula: | C24 H26 Cl N3 O3 |
| Smiles: | CC(C(N(Cc1nc(c2ccccc2)no1)C1CCCCC1)=O)Oc1cccc(c1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.2318 |
| logD: | 6.2318 |
| logSw: | -6.0768 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 53.555 |
| InChI Key: | GPCYZNFMFKQTRE-KRWDZBQOSA-N |