3-(4-methoxyphenyl)-5-(1-phenoxyethyl)-1,2,4-oxadiazole
Chemical Structure Depiction of
3-(4-methoxyphenyl)-5-(1-phenoxyethyl)-1,2,4-oxadiazole
3-(4-methoxyphenyl)-5-(1-phenoxyethyl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | D138-0040 |
| Compound Name: | 3-(4-methoxyphenyl)-5-(1-phenoxyethyl)-1,2,4-oxadiazole |
| Molecular Weight: | 296.32 |
| Molecular Formula: | C17 H16 N2 O3 |
| Smiles: | CC(c1nc(c2ccc(cc2)OC)no1)Oc1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7037 |
| logD: | 4.7037 |
| logSw: | -4.5026 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.977 |
| InChI Key: | BQZNKWZFLUGJEB-LBPRGKRZSA-N |