5-({[4-(4-fluorophenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(2-methylphenyl)-1,2,4-oxadiazole
Chemical Structure Depiction of
5-({[4-(4-fluorophenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(2-methylphenyl)-1,2,4-oxadiazole
5-({[4-(4-fluorophenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(2-methylphenyl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | D141-0030 |
| Compound Name: | 5-({[4-(4-fluorophenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(2-methylphenyl)-1,2,4-oxadiazole |
| Molecular Weight: | 381.43 |
| Molecular Formula: | C19 H16 F N5 O S |
| Smiles: | Cc1ccccc1c1nc(CSc2nnc(C)n2c2ccc(cc2)F)on1 |
| Stereo: | ACHIRAL |
| logP: | 3.8343 |
| logD: | 3.8342 |
| logSw: | -3.996 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 57.104 |
| InChI Key: | FRXYDKOHHUKQEN-UHFFFAOYSA-N |