4-[5-({[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-4-(4-methylphenyl)-4H-1,2,4-triazol-3-yl]pyridine
Chemical Structure Depiction of
4-[5-({[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-4-(4-methylphenyl)-4H-1,2,4-triazol-3-yl]pyridine
4-[5-({[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-4-(4-methylphenyl)-4H-1,2,4-triazol-3-yl]pyridine
Compound characteristics
| Compound ID: | D141-0228 |
| Compound Name: | 4-[5-({[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl}sulfanyl)-4-(4-methylphenyl)-4H-1,2,4-triazol-3-yl]pyridine |
| Molecular Weight: | 470.55 |
| Molecular Formula: | C25 H22 N6 O2 S |
| Smiles: | CCOc1ccc(cc1)c1nc(CSc2nnc(c3ccncc3)n2c2ccc(C)cc2)on1 |
| Stereo: | ACHIRAL |
| logP: | 5.4796 |
| logD: | 5.4796 |
| logSw: | -5.2996 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 72.607 |
| InChI Key: | QIUHJRMLDDODIF-UHFFFAOYSA-N |