5-({[4-(3,4-dimethylphenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(4-ethoxyphenyl)-1,2,4-oxadiazole
Chemical Structure Depiction of
5-({[4-(3,4-dimethylphenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(4-ethoxyphenyl)-1,2,4-oxadiazole
5-({[4-(3,4-dimethylphenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(4-ethoxyphenyl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | D141-0238 |
| Compound Name: | 5-({[4-(3,4-dimethylphenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-3-(4-ethoxyphenyl)-1,2,4-oxadiazole |
| Molecular Weight: | 421.52 |
| Molecular Formula: | C22 H23 N5 O2 S |
| Smiles: | CCOc1ccc(cc1)c1nc(CSc2nnc(C)n2c2ccc(C)c(C)c2)on1 |
| Stereo: | ACHIRAL |
| logP: | 5.2581 |
| logD: | 5.2579 |
| logSw: | -5.1005 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 64.228 |
| InChI Key: | VLCBKMLMLFDVFL-UHFFFAOYSA-N |