3-(4-ethoxyphenyl)-5-({[4-(4-ethoxyphenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-1,2,4-oxadiazole
Chemical Structure Depiction of
3-(4-ethoxyphenyl)-5-({[4-(4-ethoxyphenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-1,2,4-oxadiazole
3-(4-ethoxyphenyl)-5-({[4-(4-ethoxyphenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | D141-0241 |
| Compound Name: | 3-(4-ethoxyphenyl)-5-({[4-(4-ethoxyphenyl)-5-methyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-1,2,4-oxadiazole |
| Molecular Weight: | 437.52 |
| Molecular Formula: | C22 H23 N5 O3 S |
| Smiles: | CCOc1ccc(cc1)c1nc(CSc2nnc(C)n2c2ccc(cc2)OCC)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.5253 |
| logD: | 4.5252 |
| logSw: | -4.2167 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 71.351 |
| InChI Key: | LLEJTOLKSUWVGJ-UHFFFAOYSA-N |