5-ethyl-3-(4-fluorophenyl)-9-methyl-7H-furo[3,2-g][1]benzopyran-7-one
Chemical Structure Depiction of
5-ethyl-3-(4-fluorophenyl)-9-methyl-7H-furo[3,2-g][1]benzopyran-7-one
5-ethyl-3-(4-fluorophenyl)-9-methyl-7H-furo[3,2-g][1]benzopyran-7-one
Compound characteristics
| Compound ID: | D143-0067 |
| Compound Name: | 5-ethyl-3-(4-fluorophenyl)-9-methyl-7H-furo[3,2-g][1]benzopyran-7-one |
| Molecular Weight: | 322.33 |
| Molecular Formula: | C20 H15 F O3 |
| Smiles: | CCC1=CC(=O)Oc2c1cc1c(coc1c2C)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 4.9607 |
| logD: | 4.9607 |
| logSw: | -4.758 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.8511 |
| InChI Key: | IRHAPEVPQXIYAK-UHFFFAOYSA-N |