6-ethyl-2,5-dimethyl-3-phenyl-7H-furo[3,2-g][1]benzopyran-7-one
Chemical Structure Depiction of
6-ethyl-2,5-dimethyl-3-phenyl-7H-furo[3,2-g][1]benzopyran-7-one
6-ethyl-2,5-dimethyl-3-phenyl-7H-furo[3,2-g][1]benzopyran-7-one
Compound characteristics
| Compound ID: | D143-0170 |
| Compound Name: | 6-ethyl-2,5-dimethyl-3-phenyl-7H-furo[3,2-g][1]benzopyran-7-one |
| Molecular Weight: | 318.37 |
| Molecular Formula: | C21 H18 O3 |
| Smiles: | CCC1=C(C)c2cc3c(c4ccccc4)c(C)oc3cc2OC1=O |
| Stereo: | ACHIRAL |
| logP: | 5.3995 |
| logD: | 5.3995 |
| logSw: | -5.6328 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.8359 |
| InChI Key: | XBWZIPRDTJDCPP-UHFFFAOYSA-N |