6-benzyl-3-(4-fluorophenyl)-5,9-dimethyl-7H-furo[3,2-g][1]benzopyran-7-one
Chemical Structure Depiction of
6-benzyl-3-(4-fluorophenyl)-5,9-dimethyl-7H-furo[3,2-g][1]benzopyran-7-one
6-benzyl-3-(4-fluorophenyl)-5,9-dimethyl-7H-furo[3,2-g][1]benzopyran-7-one
Compound characteristics
| Compound ID: | D143-0202 |
| Compound Name: | 6-benzyl-3-(4-fluorophenyl)-5,9-dimethyl-7H-furo[3,2-g][1]benzopyran-7-one |
| Molecular Weight: | 398.43 |
| Molecular Formula: | C26 H19 F O3 |
| Smiles: | CC1=C(Cc2ccccc2)C(=O)Oc2c1cc1c(coc1c2C)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 6.5072 |
| logD: | 6.5072 |
| logSw: | -5.8616 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.0939 |
| InChI Key: | CSQNRWTWRPIAKV-UHFFFAOYSA-N |