3,5,9-trimethyl-6-(propan-2-yl)-7H-furo[3,2-g][1]benzopyran-7-one
Chemical Structure Depiction of
3,5,9-trimethyl-6-(propan-2-yl)-7H-furo[3,2-g][1]benzopyran-7-one
3,5,9-trimethyl-6-(propan-2-yl)-7H-furo[3,2-g][1]benzopyran-7-one
Compound characteristics
| Compound ID: | D143-0234 |
| Compound Name: | 3,5,9-trimethyl-6-(propan-2-yl)-7H-furo[3,2-g][1]benzopyran-7-one |
| Molecular Weight: | 270.33 |
| Molecular Formula: | C17 H18 O3 |
| Smiles: | CC(C)C1=C(C)c2cc3c(C)coc3c(C)c2OC1=O |
| Stereo: | ACHIRAL |
| logP: | 4.209 |
| logD: | 4.209 |
| logSw: | -4.3342 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.637 |
| InChI Key: | ADPDMXPRRYZJEP-UHFFFAOYSA-N |