3-(3-methoxyphenyl)-5,9-dimethyl-6-(propan-2-yl)-7H-furo[3,2-g][1]benzopyran-7-one
Chemical Structure Depiction of
3-(3-methoxyphenyl)-5,9-dimethyl-6-(propan-2-yl)-7H-furo[3,2-g][1]benzopyran-7-one
3-(3-methoxyphenyl)-5,9-dimethyl-6-(propan-2-yl)-7H-furo[3,2-g][1]benzopyran-7-one
Compound characteristics
| Compound ID: | D143-0246 |
| Compound Name: | 3-(3-methoxyphenyl)-5,9-dimethyl-6-(propan-2-yl)-7H-furo[3,2-g][1]benzopyran-7-one |
| Molecular Weight: | 362.42 |
| Molecular Formula: | C23 H22 O4 |
| Smiles: | CC(C)C1=C(C)c2cc3c(coc3c(C)c2OC1=O)c1cccc(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 5.6321 |
| logD: | 5.6321 |
| logSw: | -5.7702 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.909 |
| InChI Key: | HWJGZORFYZTRRX-UHFFFAOYSA-N |