3-(5-methyl-7-oxo-3-phenyl-7H-furo[3,2-g][1]benzopyran-6-yl)propanoic acid
Chemical Structure Depiction of
3-(5-methyl-7-oxo-3-phenyl-7H-furo[3,2-g][1]benzopyran-6-yl)propanoic acid
3-(5-methyl-7-oxo-3-phenyl-7H-furo[3,2-g][1]benzopyran-6-yl)propanoic acid
Compound characteristics
| Compound ID: | D143-0282 |
| Compound Name: | 3-(5-methyl-7-oxo-3-phenyl-7H-furo[3,2-g][1]benzopyran-6-yl)propanoic acid |
| Molecular Weight: | 348.35 |
| Molecular Formula: | C21 H16 O5 |
| Smiles: | CC1=C(CCC(O)=O)C(=O)Oc2cc3c(cc12)c(co3)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.9597 |
| logD: | 1.4635 |
| logSw: | -4.0846 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.832 |
| InChI Key: | WVDQTICJJSVLMO-UHFFFAOYSA-N |