10-(4-bromophenyl)-7-methyl-5H-6,8-dioxacyclopenta[b]phenanthren-5-one
Chemical Structure Depiction of
10-(4-bromophenyl)-7-methyl-5H-6,8-dioxacyclopenta[b]phenanthren-5-one
10-(4-bromophenyl)-7-methyl-5H-6,8-dioxacyclopenta[b]phenanthren-5-one
Compound characteristics
| Compound ID: | D143-0482 |
| Compound Name: | 10-(4-bromophenyl)-7-methyl-5H-6,8-dioxacyclopenta[b]phenanthren-5-one |
| Molecular Weight: | 405.25 |
| Molecular Formula: | C22 H13 Br O3 |
| Smiles: | Cc1c2c(cc3c(coc13)c1ccc(cc1)[Br])c1ccccc1C(=O)O2 |
| Stereo: | ACHIRAL |
| logP: | 5.9139 |
| logD: | 5.9139 |
| logSw: | -5.9702 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.0939 |
| InChI Key: | CNXKBMCEIALCHT-UHFFFAOYSA-N |