11-(4-methoxyphenyl)-8-methyl-2,3,4,5-tetrahydrocyclohepta[c]furo[3,2-g][1]benzopyran-6(1H)-one
Chemical Structure Depiction of
11-(4-methoxyphenyl)-8-methyl-2,3,4,5-tetrahydrocyclohepta[c]furo[3,2-g][1]benzopyran-6(1H)-one
11-(4-methoxyphenyl)-8-methyl-2,3,4,5-tetrahydrocyclohepta[c]furo[3,2-g][1]benzopyran-6(1H)-one
Compound characteristics
| Compound ID: | D143-0536 |
| Compound Name: | 11-(4-methoxyphenyl)-8-methyl-2,3,4,5-tetrahydrocyclohepta[c]furo[3,2-g][1]benzopyran-6(1H)-one |
| Molecular Weight: | 374.44 |
| Molecular Formula: | C24 H22 O4 |
| Smiles: | Cc1c2c(cc3c(coc13)c1ccc(cc1)OC)C1CCCCCC=1C(=O)O2 |
| Stereo: | ACHIRAL |
| logP: | 6.1377 |
| logD: | 6.1377 |
| logSw: | -5.5364 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 38.161 |
| InChI Key: | MAKWZJRYZOAUPR-UHFFFAOYSA-N |