3-[(4-chlorophenyl)methyl]-10-methyl-6-phenyl-3,4-dihydro-2H,8H-pyrano[3,2-g][1,3]benzoxazin-8-one
Chemical Structure Depiction of
3-[(4-chlorophenyl)methyl]-10-methyl-6-phenyl-3,4-dihydro-2H,8H-pyrano[3,2-g][1,3]benzoxazin-8-one
3-[(4-chlorophenyl)methyl]-10-methyl-6-phenyl-3,4-dihydro-2H,8H-pyrano[3,2-g][1,3]benzoxazin-8-one
Compound characteristics
| Compound ID: | D144-0539 |
| Compound Name: | 3-[(4-chlorophenyl)methyl]-10-methyl-6-phenyl-3,4-dihydro-2H,8H-pyrano[3,2-g][1,3]benzoxazin-8-one |
| Molecular Weight: | 417.89 |
| Molecular Formula: | C25 H20 Cl N O3 |
| Smiles: | Cc1c2c(CN(Cc3ccc(cc3)[Cl])CO2)cc2C(=CC(=O)Oc12)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.5256 |
| logD: | 5.4458 |
| logSw: | -5.8663 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 32.327 |
| InChI Key: | LFGMSNZQBQZWMX-UHFFFAOYSA-N |