3-[2-(4-methoxyphenyl)ethyl]-6,7,10-trimethyl-3,4-dihydro-2H,8H-pyrano[3,2-g][1,3]benzoxazin-8-one
Chemical Structure Depiction of
3-[2-(4-methoxyphenyl)ethyl]-6,7,10-trimethyl-3,4-dihydro-2H,8H-pyrano[3,2-g][1,3]benzoxazin-8-one
3-[2-(4-methoxyphenyl)ethyl]-6,7,10-trimethyl-3,4-dihydro-2H,8H-pyrano[3,2-g][1,3]benzoxazin-8-one
Compound characteristics
| Compound ID: | D144-0746 |
| Compound Name: | 3-[2-(4-methoxyphenyl)ethyl]-6,7,10-trimethyl-3,4-dihydro-2H,8H-pyrano[3,2-g][1,3]benzoxazin-8-one |
| Molecular Weight: | 379.45 |
| Molecular Formula: | C23 H25 N O4 |
| Smiles: | CC1=C(C)c2cc3CN(CCc4ccc(cc4)OC)COc3c(C)c2OC1=O |
| Stereo: | ACHIRAL |
| logP: | 4.608 |
| logD: | 3.4926 |
| logSw: | -4.4292 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 40.635 |
| InChI Key: | KFEFLOFXAICVLP-UHFFFAOYSA-N |