5-hydroxy-4,7-dimethyl-3-[2-oxo-2-(piperidin-1-yl)ethyl]-2H-1-benzopyran-2-one
Chemical Structure Depiction of
5-hydroxy-4,7-dimethyl-3-[2-oxo-2-(piperidin-1-yl)ethyl]-2H-1-benzopyran-2-one
5-hydroxy-4,7-dimethyl-3-[2-oxo-2-(piperidin-1-yl)ethyl]-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | D144-0909 |
| Compound Name: | 5-hydroxy-4,7-dimethyl-3-[2-oxo-2-(piperidin-1-yl)ethyl]-2H-1-benzopyran-2-one |
| Molecular Weight: | 315.37 |
| Molecular Formula: | C18 H21 N O4 |
| Smiles: | CC1=C(CC(N2CCCCC2)=O)C(=O)Oc2cc(C)cc(c12)O |
| Stereo: | ACHIRAL |
| logP: | 3.0219 |
| logD: | 2.9617 |
| logSw: | -2.8531 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.829 |
| InChI Key: | DTLPWUJYBPPSGY-UHFFFAOYSA-N |