N-[(furan-2-yl)methyl]-3-(2,3,5,9-tetramethyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-yl)propanamide
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-3-(2,3,5,9-tetramethyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-yl)propanamide
N-[(furan-2-yl)methyl]-3-(2,3,5,9-tetramethyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-yl)propanamide
Compound characteristics
| Compound ID: | D146-0066 |
| Compound Name: | N-[(furan-2-yl)methyl]-3-(2,3,5,9-tetramethyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-yl)propanamide |
| Molecular Weight: | 393.44 |
| Molecular Formula: | C23 H23 N O5 |
| Smiles: | CC1=C(CCC(NCc2ccco2)=O)C(=O)Oc2c1cc1c(C)c(C)oc1c2C |
| Stereo: | ACHIRAL |
| logP: | 4.3486 |
| logD: | 4.3486 |
| logSw: | -4.3433 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.973 |
| InChI Key: | SWZVAUWUIVBMBO-UHFFFAOYSA-N |