N-[(3-chlorophenyl)methyl]-2-(3,5,9-trimethyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-yl)acetamide
Chemical Structure Depiction of
N-[(3-chlorophenyl)methyl]-2-(3,5,9-trimethyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-yl)acetamide
N-[(3-chlorophenyl)methyl]-2-(3,5,9-trimethyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-yl)acetamide
Compound characteristics
| Compound ID: | D146-0208 |
| Compound Name: | N-[(3-chlorophenyl)methyl]-2-(3,5,9-trimethyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-yl)acetamide |
| Molecular Weight: | 409.87 |
| Molecular Formula: | C23 H20 Cl N O4 |
| Smiles: | CC1=C(CC(NCc2cccc(c2)[Cl])=O)C(=O)Oc2c1cc1c(C)coc1c2C |
| Stereo: | ACHIRAL |
| logP: | 4.7282 |
| logD: | 4.7282 |
| logSw: | -4.7819 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.837 |
| InChI Key: | MFQCIYBAKPNTLD-UHFFFAOYSA-N |