N-benzyl-2-[3-(4-fluorophenyl)-5-methyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-yl]acetamide
Chemical Structure Depiction of
N-benzyl-2-[3-(4-fluorophenyl)-5-methyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-yl]acetamide
N-benzyl-2-[3-(4-fluorophenyl)-5-methyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-yl]acetamide
Compound characteristics
| Compound ID: | D146-0422 |
| Compound Name: | N-benzyl-2-[3-(4-fluorophenyl)-5-methyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-yl]acetamide |
| Molecular Weight: | 441.46 |
| Molecular Formula: | C27 H20 F N O4 |
| Smiles: | CC1=C(CC(NCc2ccccc2)=O)C(=O)Oc2cc3c(cc12)c(co3)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 5.1355 |
| logD: | 5.1354 |
| logSw: | -5.203 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.648 |
| InChI Key: | CADFTUQEHKVYAB-UHFFFAOYSA-N |