3-(3-methoxyphenyl)-7-methylpyrido[3',2':4,5]thieno[3,2-d][1,2,3]triazin-4(3H)-one
Chemical Structure Depiction of
3-(3-methoxyphenyl)-7-methylpyrido[3',2':4,5]thieno[3,2-d][1,2,3]triazin-4(3H)-one
3-(3-methoxyphenyl)-7-methylpyrido[3',2':4,5]thieno[3,2-d][1,2,3]triazin-4(3H)-one
Compound characteristics
| Compound ID: | D148-0095 |
| Compound Name: | 3-(3-methoxyphenyl)-7-methylpyrido[3',2':4,5]thieno[3,2-d][1,2,3]triazin-4(3H)-one |
| Molecular Weight: | 324.36 |
| Molecular Formula: | C16 H12 N4 O2 S |
| Smiles: | Cc1ccc2c3c(C(N(c4cccc(c4)OC)N=N3)=O)sc2n1 |
| Stereo: | ACHIRAL |
| logP: | 4.134 |
| logD: | 4.134 |
| logSw: | -4.4622 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.332 |
| InChI Key: | VQMOYMHRTXGBKS-UHFFFAOYSA-N |