N-[(4-fluorophenyl)methyl]-7-phenyl[1,2,4]triazolo[4,3-a]pyrimidin-5-amine
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-7-phenyl[1,2,4]triazolo[4,3-a]pyrimidin-5-amine
N-[(4-fluorophenyl)methyl]-7-phenyl[1,2,4]triazolo[4,3-a]pyrimidin-5-amine
Compound characteristics
| Compound ID: | D150-0150 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-7-phenyl[1,2,4]triazolo[4,3-a]pyrimidin-5-amine |
| Molecular Weight: | 319.34 |
| Molecular Formula: | C18 H14 F N5 |
| Smiles: | C(c1ccc(cc1)F)Nc1cc(c2ccccc2)nc2nncn12 |
| Stereo: | ACHIRAL |
| logP: | 3.1726 |
| logD: | 3.1662 |
| logSw: | -3.1181 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.475 |
| InChI Key: | CHJIRUZDKQYTNC-UHFFFAOYSA-N |