5-{[(4-fluorophenyl)methyl]amino}-2-[2-(thiophen-2-yl)ethenyl]-1,3-oxazole-4-carbonitrile
Chemical Structure Depiction of
5-{[(4-fluorophenyl)methyl]amino}-2-[2-(thiophen-2-yl)ethenyl]-1,3-oxazole-4-carbonitrile
5-{[(4-fluorophenyl)methyl]amino}-2-[2-(thiophen-2-yl)ethenyl]-1,3-oxazole-4-carbonitrile
Compound characteristics
| Compound ID: | D151-0862 |
| Compound Name: | 5-{[(4-fluorophenyl)methyl]amino}-2-[2-(thiophen-2-yl)ethenyl]-1,3-oxazole-4-carbonitrile |
| Molecular Weight: | 325.36 |
| Molecular Formula: | C17 H12 F N3 O S |
| Smiles: | C(c1ccc(cc1)F)Nc1c(C#N)nc(/C=C/c2cccs2)o1 |
| Stereo: | ACHIRAL |
| logP: | 3.4962 |
| logD: | 3.4962 |
| logSw: | -3.7301 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.962 |
| InChI Key: | FWJQQTXJKCQPLW-UHFFFAOYSA-N |