4-[(4-cyclohexylpiperazin-1-yl)methyl]-6-methoxy-2H-1-benzopyran-2-one
Chemical Structure Depiction of
4-[(4-cyclohexylpiperazin-1-yl)methyl]-6-methoxy-2H-1-benzopyran-2-one
4-[(4-cyclohexylpiperazin-1-yl)methyl]-6-methoxy-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | D154-0450 |
| Compound Name: | 4-[(4-cyclohexylpiperazin-1-yl)methyl]-6-methoxy-2H-1-benzopyran-2-one |
| Molecular Weight: | 356.46 |
| Molecular Formula: | C21 H28 N2 O3 |
| Smiles: | COc1ccc2c(c1)C(CN1CCN(CC1)C1CCCCC1)=CC(=O)O2 |
| Stereo: | ACHIRAL |
| logP: | 2.9787 |
| logD: | 1.7345 |
| logSw: | -3.3516 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 35.015 |
| InChI Key: | WJTXKCKJSUDBDI-UHFFFAOYSA-N |