1-(3-hydroxyphenyl)-6,8-dimethyl-2-[(4-methylphenyl)methyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Chemical Structure Depiction of
1-(3-hydroxyphenyl)-6,8-dimethyl-2-[(4-methylphenyl)methyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
1-(3-hydroxyphenyl)-6,8-dimethyl-2-[(4-methylphenyl)methyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Compound characteristics
| Compound ID: | D159-0551 |
| Compound Name: | 1-(3-hydroxyphenyl)-6,8-dimethyl-2-[(4-methylphenyl)methyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione |
| Molecular Weight: | 425.48 |
| Molecular Formula: | C27 H23 N O4 |
| Smiles: | Cc1ccc(CN2C(C3=C(C2=O)Oc2cc(C)cc(C)c2C3=O)c2cccc(c2)O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3409 |
| logD: | 5.3286 |
| logSw: | -5.1492 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.35 |
| InChI Key: | QANONNSGBKLXOD-XMMPIXPASA-N |