1-[(2-chlorophenyl)methyl]-7-[4-(2-fluorophenyl)piperazin-1-yl]-4-methyl-1H-[1,2,3]triazolo[4,5-d]pyridazine
Chemical Structure Depiction of
1-[(2-chlorophenyl)methyl]-7-[4-(2-fluorophenyl)piperazin-1-yl]-4-methyl-1H-[1,2,3]triazolo[4,5-d]pyridazine
1-[(2-chlorophenyl)methyl]-7-[4-(2-fluorophenyl)piperazin-1-yl]-4-methyl-1H-[1,2,3]triazolo[4,5-d]pyridazine
Compound characteristics
| Compound ID: | D172-0354 |
| Compound Name: | 1-[(2-chlorophenyl)methyl]-7-[4-(2-fluorophenyl)piperazin-1-yl]-4-methyl-1H-[1,2,3]triazolo[4,5-d]pyridazine |
| Molecular Weight: | 437.91 |
| Molecular Formula: | C22 H21 Cl F N7 |
| Smiles: | Cc1c2c(c(nn1)N1CCN(CC1)c1ccccc1F)n(Cc1ccccc1[Cl])nn2 |
| Stereo: | ACHIRAL |
| logP: | 3.8912 |
| logD: | 3.891 |
| logSw: | -4.2139 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 54.875 |
| InChI Key: | RSGUHRYXVNGKRB-UHFFFAOYSA-N |