2-(4-fluorophenoxy)-N-[2-(4-methoxyphenyl)-2-(piperidin-1-yl)ethyl]acetamide
Chemical Structure Depiction of
2-(4-fluorophenoxy)-N-[2-(4-methoxyphenyl)-2-(piperidin-1-yl)ethyl]acetamide
2-(4-fluorophenoxy)-N-[2-(4-methoxyphenyl)-2-(piperidin-1-yl)ethyl]acetamide
Compound characteristics
| Compound ID: | D174-0301 |
| Compound Name: | 2-(4-fluorophenoxy)-N-[2-(4-methoxyphenyl)-2-(piperidin-1-yl)ethyl]acetamide |
| Molecular Weight: | 386.47 |
| Molecular Formula: | C22 H27 F N2 O3 |
| Smiles: | COc1ccc(cc1)C(CNC(COc1ccc(cc1)F)=O)N1CCCCC1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2076 |
| logD: | 2.6892 |
| logSw: | -3.2882 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.471 |
| InChI Key: | LAWYKEWDLDHJEG-NRFANRHFSA-N |