N~1~-(2-methoxyphenyl)-N~2~-[(1-phenylcyclopentyl)methyl]ethanediamide
Chemical Structure Depiction of
N~1~-(2-methoxyphenyl)-N~2~-[(1-phenylcyclopentyl)methyl]ethanediamide
N~1~-(2-methoxyphenyl)-N~2~-[(1-phenylcyclopentyl)methyl]ethanediamide
Compound characteristics
| Compound ID: | D178-0029 |
| Compound Name: | N~1~-(2-methoxyphenyl)-N~2~-[(1-phenylcyclopentyl)methyl]ethanediamide |
| Molecular Weight: | 352.43 |
| Molecular Formula: | C21 H24 N2 O3 |
| Smiles: | COc1ccccc1NC(C(NCC1(CCCC1)c1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6625 |
| logD: | 2.7932 |
| logSw: | -3.9389 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.234 |
| InChI Key: | XKDQKBFFZRSRTO-UHFFFAOYSA-N |