N-(2-{1-[(3-chlorophenyl)methyl]-1H-benzimidazol-2-yl}ethyl)-4-hydroxypentanamide
Chemical Structure Depiction of
N-(2-{1-[(3-chlorophenyl)methyl]-1H-benzimidazol-2-yl}ethyl)-4-hydroxypentanamide
N-(2-{1-[(3-chlorophenyl)methyl]-1H-benzimidazol-2-yl}ethyl)-4-hydroxypentanamide
Compound characteristics
| Compound ID: | D186-0391 |
| Compound Name: | N-(2-{1-[(3-chlorophenyl)methyl]-1H-benzimidazol-2-yl}ethyl)-4-hydroxypentanamide |
| Molecular Weight: | 385.89 |
| Molecular Formula: | C21 H24 Cl N3 O2 |
| Smiles: | CC(CCC(NCCc1nc2ccccc2n1Cc1cccc(c1)[Cl])=O)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.02 |
| logD: | 3.0133 |
| logSw: | -3.3071 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.934 |
| InChI Key: | COSHBZDFJNIBRV-HNNXBMFYSA-N |