1-(4-fluorobenzene-1-sulfonyl)-N-(4-methylphenyl)piperidine-3-carboxamide
Chemical Structure Depiction of
1-(4-fluorobenzene-1-sulfonyl)-N-(4-methylphenyl)piperidine-3-carboxamide
1-(4-fluorobenzene-1-sulfonyl)-N-(4-methylphenyl)piperidine-3-carboxamide
Compound characteristics
| Compound ID: | D207-0031 |
| Compound Name: | 1-(4-fluorobenzene-1-sulfonyl)-N-(4-methylphenyl)piperidine-3-carboxamide |
| Molecular Weight: | 376.45 |
| Molecular Formula: | C19 H21 F N2 O3 S |
| Smiles: | Cc1ccc(cc1)NC(C1CCCN(C1)S(c1ccc(cc1)F)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.115 |
| logD: | 3.115 |
| logSw: | -3.4619 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.974 |
| InChI Key: | IMHZSSQQCKBCNH-HNNXBMFYSA-N |