N~4~-(2,4-dimethylphenyl)-N~1~-(4-methylphenyl)piperidine-1,4-dicarboxamide
Chemical Structure Depiction of
N~4~-(2,4-dimethylphenyl)-N~1~-(4-methylphenyl)piperidine-1,4-dicarboxamide
N~4~-(2,4-dimethylphenyl)-N~1~-(4-methylphenyl)piperidine-1,4-dicarboxamide
Compound characteristics
| Compound ID: | D207-0061 |
| Compound Name: | N~4~-(2,4-dimethylphenyl)-N~1~-(4-methylphenyl)piperidine-1,4-dicarboxamide |
| Molecular Weight: | 365.47 |
| Molecular Formula: | C22 H27 N3 O2 |
| Smiles: | Cc1ccc(cc1)NC(N1CCC(CC1)C(Nc1ccc(C)cc1C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9823 |
| logD: | 3.9823 |
| logSw: | -3.8134 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.101 |
| InChI Key: | HSNRLSMPJDLIBX-UHFFFAOYSA-N |