N-benzyl-2-[2-(5-methoxy-1-benzofuran-3-yl)acetamido]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Chemical Structure Depiction of
N-benzyl-2-[2-(5-methoxy-1-benzofuran-3-yl)acetamido]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
N-benzyl-2-[2-(5-methoxy-1-benzofuran-3-yl)acetamido]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Compound characteristics
| Compound ID: | D208-0104 |
| Compound Name: | N-benzyl-2-[2-(5-methoxy-1-benzofuran-3-yl)acetamido]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| Molecular Weight: | 474.58 |
| Molecular Formula: | C27 H26 N2 O4 S |
| Smiles: | [H]N(C(Cc1coc2ccc(cc12)OC)=O)c1c(C(NCc2ccccc2)=O)c2CCCCc2s1 |
| Stereo: | ACHIRAL |
| logP: | 4.9259 |
| logD: | 4.0228 |
| logSw: | -4.9319 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 64.348 |
| InChI Key: | NRFABBOKIKWPRA-UHFFFAOYSA-N |