5-butyl-2-(5-methoxy-1H-indol-3-yl)-7-methyl-1,3-diazatricyclo[3.3.1.1~3,7~]decan-6-one
Chemical Structure Depiction of
5-butyl-2-(5-methoxy-1H-indol-3-yl)-7-methyl-1,3-diazatricyclo[3.3.1.1~3,7~]decan-6-one
5-butyl-2-(5-methoxy-1H-indol-3-yl)-7-methyl-1,3-diazatricyclo[3.3.1.1~3,7~]decan-6-one
Compound characteristics
| Compound ID: | D210-0085 |
| Compound Name: | 5-butyl-2-(5-methoxy-1H-indol-3-yl)-7-methyl-1,3-diazatricyclo[3.3.1.1~3,7~]decan-6-one |
| Molecular Weight: | 367.49 |
| Molecular Formula: | C22 H29 N3 O2 |
| Smiles: | CCCCC12CN3CC(C)(CN(C1)C3c1c[nH]c3ccc(cc13)OC)C2=O |
| Stereo: | ACHIRAL |
| logP: | 3.873 |
| logD: | 3.8726 |
| logSw: | -4.0337 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.333 |
| InChI Key: | RVNGLTDIORCCNE-UHFFFAOYSA-N |