1-(2,4-dimethylphenyl)-4-[4-(1H-tetrazol-1-yl)benzene-1-sulfonyl]piperazine
Chemical Structure Depiction of
1-(2,4-dimethylphenyl)-4-[4-(1H-tetrazol-1-yl)benzene-1-sulfonyl]piperazine
1-(2,4-dimethylphenyl)-4-[4-(1H-tetrazol-1-yl)benzene-1-sulfonyl]piperazine
Compound characteristics
| Compound ID: | D216-0256 |
| Compound Name: | 1-(2,4-dimethylphenyl)-4-[4-(1H-tetrazol-1-yl)benzene-1-sulfonyl]piperazine |
| Molecular Weight: | 398.49 |
| Molecular Formula: | C19 H22 N6 O2 S |
| Smiles: | Cc1ccc(c(C)c1)N1CCN(CC1)S(c1ccc(cc1)n1cnnn1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6043 |
| logD: | 3.6043 |
| logSw: | -3.9153 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 74.674 |
| InChI Key: | FWEMZPBJGHASAB-UHFFFAOYSA-N |