3-fluoro-N-[2-(1-{2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl}-1H-tetrazol-5-yl)phenyl]benzamide
Chemical Structure Depiction of
3-fluoro-N-[2-(1-{2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl}-1H-tetrazol-5-yl)phenyl]benzamide
3-fluoro-N-[2-(1-{2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl}-1H-tetrazol-5-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | D216-0658 |
| Compound Name: | 3-fluoro-N-[2-(1-{2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl}-1H-tetrazol-5-yl)phenyl]benzamide |
| Molecular Weight: | 421.39 |
| Molecular Formula: | C20 H16 F N7 O3 |
| Smiles: | Cc1cc(NC(Cn2c(c3ccccc3NC(c3cccc(c3)F)=O)nnn2)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 2.6625 |
| logD: | 2.6452 |
| logSw: | -3.4189 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 106.509 |
| InChI Key: | NYWMZIXMHASTIM-UHFFFAOYSA-N |