2-(4-chlorophenyl)-5-(hydroxymethyl)-N-[(4-methylphenyl)methyl]-2H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
2-(4-chlorophenyl)-5-(hydroxymethyl)-N-[(4-methylphenyl)methyl]-2H-1,2,3-triazole-4-carboxamide
2-(4-chlorophenyl)-5-(hydroxymethyl)-N-[(4-methylphenyl)methyl]-2H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | D217-0313 |
| Compound Name: | 2-(4-chlorophenyl)-5-(hydroxymethyl)-N-[(4-methylphenyl)methyl]-2H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 356.81 |
| Molecular Formula: | C18 H17 Cl N4 O2 |
| Smiles: | Cc1ccc(CNC(c2c(CO)nn(c3ccc(cc3)[Cl])n2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.6684 |
| logD: | 2.6684 |
| logSw: | -3.3426 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.136 |
| InChI Key: | DWKZXPUARGKLTD-UHFFFAOYSA-N |