2-(4-fluorophenyl)-5-(hydroxymethyl)-N-[(pyridin-2-yl)methyl]-2H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
2-(4-fluorophenyl)-5-(hydroxymethyl)-N-[(pyridin-2-yl)methyl]-2H-1,2,3-triazole-4-carboxamide
2-(4-fluorophenyl)-5-(hydroxymethyl)-N-[(pyridin-2-yl)methyl]-2H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | D217-0422 |
| Compound Name: | 2-(4-fluorophenyl)-5-(hydroxymethyl)-N-[(pyridin-2-yl)methyl]-2H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 327.32 |
| Molecular Formula: | C16 H14 F N5 O2 |
| Smiles: | C(c1ccccn1)NC(c1c(CO)nn(c2ccc(cc2)F)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 0.7695 |
| logD: | 0.7692 |
| logSw: | -1.4938 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.679 |
| InChI Key: | DCYNOKRUJMXXEO-UHFFFAOYSA-N |