N-[(furan-2-yl)methyl]-4-nitro-N-[(thiophen-2-yl)methyl]benzamide
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-4-nitro-N-[(thiophen-2-yl)methyl]benzamide
N-[(furan-2-yl)methyl]-4-nitro-N-[(thiophen-2-yl)methyl]benzamide
Compound characteristics
| Compound ID: | D220-0022 |
| Compound Name: | N-[(furan-2-yl)methyl]-4-nitro-N-[(thiophen-2-yl)methyl]benzamide |
| Molecular Weight: | 342.37 |
| Molecular Formula: | C17 H14 N2 O4 S |
| Smiles: | C(c1ccco1)N(Cc1cccs1)C(c1ccc(cc1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4867 |
| logD: | 3.4867 |
| logSw: | -3.715 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 58.327 |
| InChI Key: | CQLPCPBPMPCPEO-UHFFFAOYSA-N |