4-ethoxy-N-[(furan-2-yl)methyl]-N-[(thiophen-2-yl)methyl]benzamide
Chemical Structure Depiction of
4-ethoxy-N-[(furan-2-yl)methyl]-N-[(thiophen-2-yl)methyl]benzamide
4-ethoxy-N-[(furan-2-yl)methyl]-N-[(thiophen-2-yl)methyl]benzamide
Compound characteristics
| Compound ID: | D220-0023 |
| Compound Name: | 4-ethoxy-N-[(furan-2-yl)methyl]-N-[(thiophen-2-yl)methyl]benzamide |
| Molecular Weight: | 341.43 |
| Molecular Formula: | C19 H19 N O3 S |
| Smiles: | CCOc1ccc(cc1)C(N(Cc1ccco1)Cc1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.93 |
| logD: | 3.93 |
| logSw: | -3.8288 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.069 |
| InChI Key: | OGQXIXWDTJZSMA-UHFFFAOYSA-N |