N-[(4-ethylphenyl)methyl]-N-[(furan-2-yl)methyl]-2-(4-methoxyphenoxy)acetamide
Chemical Structure Depiction of
N-[(4-ethylphenyl)methyl]-N-[(furan-2-yl)methyl]-2-(4-methoxyphenoxy)acetamide
N-[(4-ethylphenyl)methyl]-N-[(furan-2-yl)methyl]-2-(4-methoxyphenoxy)acetamide
Compound characteristics
| Compound ID: | D220-0274 |
| Compound Name: | N-[(4-ethylphenyl)methyl]-N-[(furan-2-yl)methyl]-2-(4-methoxyphenoxy)acetamide |
| Molecular Weight: | 379.45 |
| Molecular Formula: | C23 H25 N O4 |
| Smiles: | CCc1ccc(CN(Cc2ccco2)C(COc2ccc(cc2)OC)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.3316 |
| logD: | 4.3316 |
| logSw: | -4.2825 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 38.442 |
| InChI Key: | SYFZSXFUKLMILF-UHFFFAOYSA-N |