2-(2,3-dimethylphenoxy)-N-[(furan-2-yl)methyl]-N-{[4-(propan-2-yl)phenyl]methyl}acetamide
Chemical Structure Depiction of
2-(2,3-dimethylphenoxy)-N-[(furan-2-yl)methyl]-N-{[4-(propan-2-yl)phenyl]methyl}acetamide
2-(2,3-dimethylphenoxy)-N-[(furan-2-yl)methyl]-N-{[4-(propan-2-yl)phenyl]methyl}acetamide
Compound characteristics
| Compound ID: | D220-0357 |
| Compound Name: | 2-(2,3-dimethylphenoxy)-N-[(furan-2-yl)methyl]-N-{[4-(propan-2-yl)phenyl]methyl}acetamide |
| Molecular Weight: | 391.51 |
| Molecular Formula: | C25 H29 N O3 |
| Smiles: | CC(C)c1ccc(CN(Cc2ccco2)C(COc2cccc(C)c2C)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.6347 |
| logD: | 5.6347 |
| logSw: | -5.5517 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.985 |
| InChI Key: | SMULJDZIUCTEFW-UHFFFAOYSA-N |