N-[4-(3,4-dimethoxyphenyl)-1,2,5-oxadiazol-3-yl]-4-ethoxybenzamide
Chemical Structure Depiction of
N-[4-(3,4-dimethoxyphenyl)-1,2,5-oxadiazol-3-yl]-4-ethoxybenzamide
N-[4-(3,4-dimethoxyphenyl)-1,2,5-oxadiazol-3-yl]-4-ethoxybenzamide
Compound characteristics
| Compound ID: | D220-0912 |
| Compound Name: | N-[4-(3,4-dimethoxyphenyl)-1,2,5-oxadiazol-3-yl]-4-ethoxybenzamide |
| Molecular Weight: | 369.38 |
| Molecular Formula: | C19 H19 N3 O5 |
| Smiles: | [H]N(C(c1ccc(cc1)OCC)=O)c1c(c2ccc(c(c2)OC)OC)non1 |
| Stereo: | ACHIRAL |
| logP: | 3.6658 |
| logD: | 3.6405 |
| logSw: | -3.8589 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.47 |
| InChI Key: | ZQTFPCKKIUHXFA-UHFFFAOYSA-N |