N-[4-(3,4-dimethoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-propoxybenzamide
Chemical Structure Depiction of
N-[4-(3,4-dimethoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-propoxybenzamide
N-[4-(3,4-dimethoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-propoxybenzamide
Compound characteristics
| Compound ID: | D220-0966 |
| Compound Name: | N-[4-(3,4-dimethoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-propoxybenzamide |
| Molecular Weight: | 383.4 |
| Molecular Formula: | C20 H21 N3 O5 |
| Smiles: | [H]N(C(c1ccccc1OCCC)=O)c1c(c2ccc(c(c2)OC)OC)non1 |
| Stereo: | ACHIRAL |
| logP: | 4.2523 |
| logD: | 3.731 |
| logSw: | -4.3209 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.851 |
| InChI Key: | CMBUTBNHCUKSRM-UHFFFAOYSA-N |