N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-methylpropanamide
Chemical Structure Depiction of
N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-methylpropanamide
N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-methylpropanamide
Compound characteristics
| Compound ID: | D220-1099 |
| Compound Name: | N-[4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-yl]-2-methylpropanamide |
| Molecular Weight: | 261.28 |
| Molecular Formula: | C13 H15 N3 O3 |
| Smiles: | [H]N(C(C(C)C)=O)c1c(c2ccc(cc2)OC)non1 |
| Stereo: | ACHIRAL |
| logP: | 3.0613 |
| logD: | 3.0555 |
| logSw: | -3.4391 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.901 |
| InChI Key: | WQRIDSQKZMBRGH-UHFFFAOYSA-N |