3-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Chemical Structure Depiction of
3-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
3-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Compound characteristics
| Compound ID: | D221-0092 |
| Compound Name: | 3-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| Molecular Weight: | 360.31 |
| Molecular Formula: | C13 H11 F3 N4 O3 S |
| Smiles: | COc1cc(cc(c1OC)OC)c1nn2c(C(F)(F)F)nnc2s1 |
| Stereo: | ACHIRAL |
| logP: | 2.3281 |
| logD: | 2.3281 |
| logSw: | -2.4159 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.971 |
| InChI Key: | ZFPIVELMMRXCLB-UHFFFAOYSA-N |